| CAS | 25655-41-8 |
| MF | C6H9I2NO |
| MW | 364.95 |
| EINECS | 607-771-8 |
| Melting point | 300 °C |
| Storage temp | Keep in dark place,Inert atmosphere,Room temperature |
| Sample | Available |
| MOQ | 1KG |
| Packaging | 25kg per drum |
| Shelf Life | 2 years |
| Brand | Duling |
| Other names | PVP iodine |
| Shipping method | By express/ sea/ air |
| Povidone iodine Chemical Properties |
| Melting point | 300 °C |
| storage temp. | Keep in dark place,Inert atmosre,Room temperature |
| solubility | H2O: soluble100mg/mL |
| form | Powder |
| color | Yellow-brown |
| Water Solubility | Soluble in water, ethyl alcohol, isopropyl alcohol, polyethylene glycol and glycerol. Insoluble in chloroform, carbon tetrachloride, hexane, acetone and petroleum ether. |
| Merck | 13,7784 |
| InChI | InChI=1S/C6H9NO.I2/c1-2-7-5-3-4-6(7)8;1-2/h2H,1,3-5H2; |
| InChIKey | FAAHNQAYWKTLFD-UHFFFAOYSA-N |
| SMILES | II.C(N1CCCC1=O)=C |
| CAS DataBase Reference | 25655-41-8(CAS DataBase Reference) |
| EPA Substance Registry System | Povidone-iodine (25655-41-8) |
Signup today to claim your Discount. Get Started before it's too late!
