| CAS | 16595-80-5 |
| MF | C11H13ClN2S |
| MW | 240.75 |
| EINECS | 240-654-6 |
| Melting point | 266-267 °C |
| Storage temp | 2-8°C |
| Sample | Available |
| MOQ | 1KG |
| Packaging | 25kg per drum |
| Brand | Duling |
| Other names | L-2,3,5,6-Tetrahydro-6-phenylimidazo-[2,1-6]-thiazole |
| Shipping method | By express/ sea/ air |
| Levamisole hydrochloride Chemical Properties |
| Melting point | 266-267 °C(lit.) |
| al | -128 º (c=5, H2O) |
| refractive index | -126 ° (C=1, H2O) |
| Fp | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, soluble in ethanol (96 per cent), slightly soluble in methylene chloride. |
| form | Crystaler |
| color | White to almost white |
| Water Solubility | 210 g/L (20 ºC) |
| Merck | 14,5459 |
| BRN | 4358988 |
| InChI | InChI=1/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/s3 |
| InChIKey | LAZPBGZRMVRFKY-HNCPQSOCSA-N |
| SMILES | [C@H]1(N=C2SCCN2C1)C1=CC=CC=C1.Cl |&1:0,r| |
| CAS DataBase Reference | 16595-80-5(CAS DataBase Reference) |
| EPA Substance Registry System | Levamisole hydrochloride (16595-80-5) |
Signup today to claim your Discount. Get Started before it's too late!
