| Product Name: | 7-Hydroxymitragynine |
| +8617103030563 | |
| Telagram | +8617103030563 |
| Wickrme | Lookme2022 |
| Threema | FXMRNNX8 |
| Signal | +447469289839 |
We have a long term collaboration with institutions home and abroad, such as the University of Pittsburgh in the US, the Dalian Institute of Chemical sics and Shenyang Research Institute of Chemical Industry, ensuring a strong product research and development. So far, we have had 35 proprietary technologies and 15 patents, among which 4 patents are of invention type, 11 patents are practical ones, as a top quality supplier around the country.
| CAS: | 174418-82-7 |
| MF: | C23H30N2O5 |
| MW: | 414.49 |
| EINECS: | |
| Product Categories: | Herb extract;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Metabolites & Impurities;rmaceuticals |
| Mol File: | 174418-82-7.mol |
| Boiling point | 567.4±50.0 °C(Predicted) |
| density | 1.29±0.1 g/cm3(Predicted) |
| Fp | 2℃ |
| storage temp. | -20°C Freezer |
| solubility | Ethanol: 5 mg/ml; Methanol: 10 mg/ml |
| form | A crystald |
| pka | 12.20±0.60(Predicted) |
| InChIKey | RYENLSMHLCNXJT-XIYIOZPINA-N |
| SMILES | c1c(OC)c2[C@]3(O)CCN4C[C@@H](CC)[C@@H](/C(/C(=O)OC)=C\OC)C[C@@H]4C3=Nc2cc1 |&1:5,11,14,24,r| |
Signup today to claim your Discount. Get Started before it's too late!
